CAS 89108-58-7 is the registry number for Sch 33303. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2-oxo-1-phenyl-3-prop-2-enyl-1,8-naphthyridin-4-yl) acetate (CAS 89108-58-7) is a chemical compound with the molecular formula C19H16N2O3 and a molecular weight of 320.3 g/mol. IUPAC name: (2-oxo-1-phenyl-3-prop-2-enyl-1,8-naphthyridin-4-yl) acetate. InChIKey: LKJRSIKJPNFWNO-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O3 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | (2-oxo-1-phenyl-3-prop-2-enyl-1,8-naphthyridin-4-yl) acetate |
| InChIKey | LKJRSIKJPNFWNO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C(=O)N(C2=C1C=CC=N2)C3=CC=CC=C3)CC=C |
Computed by PubChem (NCBI)