CAS 892293-58-2 is the registry number for 1-(3,5-Dimethylphenyl)-1,4-dihydropyrazine-2,3-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,5-dimethylphenyl)-1H-pyrazine-2,3-dione (CAS 892293-58-2) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 4-(3,5-dimethylphenyl)-1H-pyrazine-2,3-dione. InChIKey: AJMFUUZKMKHLFQ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 4-(3,5-dimethylphenyl)-1H-pyrazine-2,3-dione |
| InChIKey | AJMFUUZKMKHLFQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C=CNC(=O)C2=O)C |
Computed by PubChem (NCBI)