CAS 89284-80-0 is the registry number for 3,5-Dichloro-6-Methylpyrazine-2-Carbonitrile. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dichloro-6-methylpyrazine-2-carbonitrile (CAS 89284-80-0) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 3,5-dichloro-6-methylpyrazine-2-carbonitrile. InChIKey: PAYYYFUGHRYJGP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 3,5-dichloro-6-methylpyrazine-2-carbonitrile |
| InChIKey | PAYYYFUGHRYJGP-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C#N)Cl)Cl |
Computed by PubChem (NCBI)