Products 892878-59-0

CAS 892878-59-0 is the registry number for 3-Fluoro-4-hydroxy-5-methylbenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

3-fluoro-4-hydroxy-5-methylbenzoic acid (CAS 892878-59-0) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: 3-fluoro-4-hydroxy-5-methylbenzoic acid. InChIKey: RUIQTJCKSUQPHU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FO3
Molecular weight170.14 g/mol
IUPAC name3-fluoro-4-hydroxy-5-methylbenzoic acid
InChIKeyRUIQTJCKSUQPHU-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1O)F)C(=O)O

Computed by PubChem (NCBI)