Products 89339-17-3
CAS 89339-17-3 is the registry number for Salicylmethylecgonine. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
Methyl (1R,2R,3S,5R)-3-(2-hydroxybenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 89339-17-3) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: methyl (1R,2R,3S,5R)-3-(2-hydroxybenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: PEISRHQJLATJPJ-WAZAZEMKSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | methyl (1R,2R,3S,5R)-3-(2-hydroxybenzoyl)oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | PEISRHQJLATJPJ-WAZAZEMKSA-N |
| SMILES | CN1[C@@H]2CC[C@@H]1[C@H]([C@H](C2)OC(=O)C3=CC=CC=C3O)C(=O)OC |
Computed by PubChem (NCBI)