CAS 893393-98-1 is the registry number for 6-(Oxazol-2-yl)indolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(1,3-oxazol-2-yl)-1,3-dihydroindol-2-one (CAS 893393-98-1) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 6-(1,3-oxazol-2-yl)-1,3-dihydroindol-2-one. InChIKey: XSWKAGIOZQRYOF-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 6-(1,3-oxazol-2-yl)-1,3-dihydroindol-2-one |
| InChIKey | XSWKAGIOZQRYOF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C3=NC=CO3)NC1=O |
Computed by PubChem (NCBI)