CAS 89354-15-4 is the registry number for Azepinomycin. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
6-hydroxy-4,5,6,7-tetrahydro-1H-imidazo[4,5-e][1,4]diazepin-8-one (CAS 89354-15-4) is a chemical compound with the molecular formula C6H8N4O2 and a molecular weight of 168.15 g/mol. IUPAC name: 6-hydroxy-4,5,6,7-tetrahydro-1H-imidazo[4,5-e][1,4]diazepin-8-one. InChIKey: HCLYCONTUAROEE-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O2 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 6-hydroxy-4,5,6,7-tetrahydro-1H-imidazo[4,5-e][1,4]diazepin-8-one |
| InChIKey | HCLYCONTUAROEE-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)C2=C(N1)N=CN2)O |
Computed by PubChem (NCBI)