Products 893641-10-6
CAS 893641-10-6 is the registry number for 4'-Fluoro-biphenyl-4-propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[4-(4-fluorophenyl)phenyl]propanoic acid (CAS 893641-10-6) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. IUPAC name: 3-[4-(4-fluorophenyl)phenyl]propanoic acid. InChIKey: POPINLYDNNPCCT-UHFFFAOYSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 3-[4-(4-fluorophenyl)phenyl]propanoic acid |
| InChIKey | POPINLYDNNPCCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)
Synonyms:
4'-Fluoro-biphenyl-4-propanoic acid, [1,1'-Biphenyl]-4-propanoicacid, 4'-fluoro-, 3-[4-(4-fluorophenyl)phenyl]propanoic acid, 3-(4'-Fluoro-[1,1'-biphenyl]-4-yl)propanoic acid, POPINLYDNNPCCT-UHFFFAOYSA-N, 4'-Fluorobiphenyl-4-propanoic acid, 3-(4'-fluorobiphenyl-4-yl)propanoic acid, 3-(4'-Fluoro[1,1'-biphenyl]-4-yl)propanoic acid