CAS 893723-59-6 appears in our catalog under these names: 5–(Methylsulfonyl)nicotinic Acid, 5-(Methylsulfonyl)nicotinic acid, 5-(Methylsulfonyl)nicotinic acid, 97%, 97%, 5-(Methylsulfonyl)nicotinic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
5-methylsulfonylpyridine-3-carboxylic acid (CAS 893723-59-6) is a chemical compound with the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. IUPAC name: 5-methylsulfonylpyridine-3-carboxylic acid. InChIKey: FFCWPCHCXVDCBZ-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4S |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 5-methylsulfonylpyridine-3-carboxylic acid |
| InChIKey | FFCWPCHCXVDCBZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CN=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)