CAS 893737-04-7 is the registry number for 4'-(1,3-Dioxolan-2-yl)-[1,1'-biphenyl]-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[4-(1,3-dioxolan-2-yl)phenyl]benzaldehyde (CAS 893737-04-7) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: 4-[4-(1,3-dioxolan-2-yl)phenyl]benzaldehyde. InChIKey: MHEHYWBDTJADSL-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 4-[4-(1,3-dioxolan-2-yl)phenyl]benzaldehyde |
| InChIKey | MHEHYWBDTJADSL-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC=C(C=C2)C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)