Products 89402-40-4

CAS 89402-40-4 is the registry number for Clodinafop-phenol Metabolite, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.

Structural formula: {0} (CAS {1})

4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenol (CAS 89402-40-4) is a chemical compound with the molecular formula C11H7ClFNO2 and a molecular weight of 239.63 g/mol. IUPAC name: 4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenol. InChIKey: QRDGJZIEMNJEKN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClFNO2
Molecular weight239.63 g/mol
IUPAC name4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenol
InChIKeyQRDGJZIEMNJEKN-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1O)OC2=C(C=C(C=N2)Cl)F

Computed by PubChem (NCBI)