CAS 89402-40-4 is the registry number for Clodinafop-phenol Metabolite, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenol (CAS 89402-40-4) is a chemical compound with the molecular formula C11H7ClFNO2 and a molecular weight of 239.63 g/mol. IUPAC name: 4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenol. InChIKey: QRDGJZIEMNJEKN-UHFFFAOYSA-N.
| Molecular formula | C11H7ClFNO2 |
|---|---|
| Molecular weight | 239.63 g/mol |
| IUPAC name | 4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenol |
| InChIKey | QRDGJZIEMNJEKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=C(C=N2)Cl)F |
Computed by PubChem (NCBI)