Products 894853-05-5
CAS 894853-05-5 is the registry number for 3-Formyl-n-methyl-1h-indole-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-formyl-N-methyl-1H-indole-2-carboxamide (CAS 894853-05-5) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3-formyl-N-methyl-1H-indole-2-carboxamide. InChIKey: LEEZPEBDPSCEGB-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-formyl-N-methyl-1H-indole-2-carboxamide |
| InChIKey | LEEZPEBDPSCEGB-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C2=CC=CC=C2N1)C=O |
Computed by PubChem (NCBI)