Products 896729-07-0
CAS 896729-07-0 appears in our catalog under these names: Imrecoxib Impurity 1, Imrecoxib Impurity 1-d7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[4-(hydroxymethyl)phenyl]-3-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one (CAS 896729-07-0) is a chemical compound with the molecular formula C21H23NO4S and a molecular weight of 385.5 g/mol. IUPAC name: 4-[4-(hydroxymethyl)phenyl]-3-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one. InChIKey: HOQRPUGACQIBBI-UHFFFAOYSA-N.
| Molecular formula | C21H23NO4S |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | 4-[4-(hydroxymethyl)phenyl]-3-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one |
| InChIKey | HOQRPUGACQIBBI-UHFFFAOYSA-N |
| SMILES | CCCN1CC(=C(C1=O)C2=CC=C(C=C2)CO)C3=CC=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)