Products 1246815-11-1
CAS 1246815-11-1 appears in our catalog under these names: Racecadotril–d5, Racecadotril-d5, Racecadotril-d5, >95% (HPLC). Offered by: GLPBio, Chemat Brand, TRC, TargetMol, Biosynth. Available pack sizes: 1mg, on request, 100mg, 10mg, 25mg, 5mg, 50mg, 1 mg.
(2,3,4,5,6-pentadeuteriophenyl)methyl 2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]acetate (CAS 1246815-11-1) is a chemical compound with the molecular formula C21H23NO4S and a molecular weight of 390.5 g/mol. IUPAC name: (2,3,4,5,6-pentadeuteriophenyl)methyl 2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]acetate. InChIKey: ODUOJXZPIYUATO-LKOJFEAXSA-N.
| Molecular formula | C21H23NO4S |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentadeuteriophenyl)methyl 2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]acetate |
| InChIKey | ODUOJXZPIYUATO-LKOJFEAXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])COC(=O)CNC(=O)C(CC2=CC=CC=C2)CSC(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Racecadotril-d5, orb1738335