Products 2306276-21-9
CAS 2306276-21-9 is the registry number for 1'-Tosylspiro[cyclohexane-1,3'-indoline]-5'-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methylphenyl)sulfonylspiro[2H-indole-3,1'-cyclohexane]-5-carboxylic acid (CAS 2306276-21-9) is a chemical compound with the molecular formula C21H23NO4S and a molecular weight of 385.5 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylspiro[2H-indole-3,1'-cyclohexane]-5-carboxylic acid. InChIKey: MLYHKVYUVUZXJT-UHFFFAOYSA-N.
| Molecular formula | C21H23NO4S |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylspiro[2H-indole-3,1'-cyclohexane]-5-carboxylic acid |
| InChIKey | MLYHKVYUVUZXJT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3(CCCCC3)C4=C2C=CC(=C4)C(=O)O |
Computed by PubChem (NCBI)