Products 500872-34-4

CAS 500872-34-4 is the registry number for Fmoc-Met-OMe, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfanylbutanoate (CAS 500872-34-4) is a chemical compound with the molecular formula C21H23NO4S and a molecular weight of 385.5 g/mol. IUPAC name: methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfanylbutanoate. InChIKey: IFJCGJSZSLVCPG-IBGZPJMESA-N.

Identity
Molecular formulaC21H23NO4S
Molecular weight385.5 g/mol
IUPAC namemethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfanylbutanoate
InChIKeyIFJCGJSZSLVCPG-IBGZPJMESA-N
SMILESCOC(=O)[C@H](CCSC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)

Synonyms: Fmoc-Met-OMe