CAS 896736-22-4 appears in our catalog under these names: Ramelteon Impurity 10, Ramelteon Impurity 24, N-(2-((8R)-1,6,7,8-Tetrahydro-6-oxo-2H-indeno(5,4-b)furan-8-yl)ethyl)propanamide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 75mg, 5mg, 10mg, 25mg, 50mg.
N-[2-[(8R)-6-oxo-1,2,7,8-tetrahydrocyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide (CAS 896736-22-4) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: N-[2-[(8R)-6-oxo-1,2,7,8-tetrahydrocyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide. InChIKey: NWAGAOSALVFUPI-SNVBAGLBSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | N-[2-[(8R)-6-oxo-1,2,7,8-tetrahydrocyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChIKey | NWAGAOSALVFUPI-SNVBAGLBSA-N |
| SMILES | CCC(=O)NCC[C@@H]1CC(=O)C2=C1C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)