Products 89692-60-4

CAS 89692-60-4 is the registry number for 2-Chloro-6-methyl-5-nitronicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-chloro-6-methyl-5-nitropyridine-3-carboxylic acid (CAS 89692-60-4) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 2-chloro-6-methyl-5-nitropyridine-3-carboxylic acid. InChIKey: QHPBKHRZIKVYOV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClN2O4
Molecular weight216.58 g/mol
IUPAC name2-chloro-6-methyl-5-nitropyridine-3-carboxylic acid
InChIKeyQHPBKHRZIKVYOV-UHFFFAOYSA-N
SMILESCC1=C(C=C(C(=N1)Cl)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)