Products 96-90-2
CAS 96-90-2 appears in our catalog under these names: 1–Chloro–2–methyl–3，5–dinitrobenzene, 1-Chloro-2-methyl-3,5-dinitrobenzene, 98%, 1-Chloro-2-methyl-3,5-dinitrobenzene 95%, 1-Chloro-2-methyl-3,5-dinitrobenzene, 95%, Benzene, 1-chloro-2-methyl-3,5-dinitro-, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-chloro-2-methyl-3,5-dinitrobenzene (CAS 96-90-2) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 1-chloro-2-methyl-3,5-dinitrobenzene. InChIKey: UECPDWARCDGMQV-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 1-chloro-2-methyl-3,5-dinitrobenzene |
| InChIKey | UECPDWARCDGMQV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)