CAS 773109-32-3 appears in our catalog under these names: 2–AMINO–3–CHLORO–5–NITROBENZOIC ACID, 2-Amino-3-chloro-5-nitrobenzoic acid, 95%, 2-AMINO-3-CHLORO-5-NITROBENZOIC ACID, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-amino-3-chloro-5-nitrobenzoic acid (CAS 773109-32-3) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 2-amino-3-chloro-5-nitrobenzoic acid. InChIKey: KHXIPGBFCRIAME-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 2-amino-3-chloro-5-nitrobenzoic acid |
| InChIKey | KHXIPGBFCRIAME-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)