CAS 170099-17-9 is the registry number for 1-Chloro-4-methyl-2,3-dinitrobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-4-methyl-2,3-dinitrobenzene (CAS 170099-17-9) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 1-chloro-4-methyl-2,3-dinitrobenzene. InChIKey: SFAGKMVMGOXNSK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 1-chloro-4-methyl-2,3-dinitrobenzene |
| InChIKey | SFAGKMVMGOXNSK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)