Products 897296-66-1
CAS 897296-66-1 is the registry number for 2-((4-methylphenyl)sulfonyl)-3-(3-pyridyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
(E)-2-(4-methylphenyl)sulfonyl-3-pyridin-3-ylprop-2-enenitrile (CAS 897296-66-1) is a chemical compound with the molecular formula C15H12N2O2S and a molecular weight of 284.3 g/mol. IUPAC name: (E)-2-(4-methylphenyl)sulfonyl-3-pyridin-3-ylprop-2-enenitrile. InChIKey: DQICACAYOYNJIG-OQLLNIDSSA-N.
| Molecular formula | C15H12N2O2S |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | (E)-2-(4-methylphenyl)sulfonyl-3-pyridin-3-ylprop-2-enenitrile |
| InChIKey | DQICACAYOYNJIG-OQLLNIDSSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)/C(=C/C2=CN=CC=C2)/C#N |
Computed by PubChem (NCBI)