Products 897545-76-5
CAS 897545-76-5 is the registry number for N-(2,6-dimethylphenyl)-N,4-dimethylbenzenesulfonamide, 95%. Offered by: Chemat. Available pack sizes: 1g.
N-(2,6-dimethylphenyl)-N,4-dimethylbenzenesulfonamide (CAS 897545-76-5) is a chemical compound with the molecular formula C16H19NO2S and a molecular weight of 289.4 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-N,4-dimethylbenzenesulfonamide. InChIKey: JGOSEBXYGQNDPC-UHFFFAOYSA-N.
| Molecular formula | C16H19NO2S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-N,4-dimethylbenzenesulfonamide |
| InChIKey | JGOSEBXYGQNDPC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(C)C2=C(C=CC=C2C)C |
Computed by PubChem (NCBI)