CAS 897554-25-5 appears in our catalog under these names: 2-Cyclopropyl-6,8-dimethylquinoline-4-carboxylic acid, 95%, 2-Cyclopropyl-6,8-dimethylquinoline-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-cyclopropyl-6,8-dimethylquinoline-4-carboxylic acid (CAS 897554-25-5) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 2-cyclopropyl-6,8-dimethylquinoline-4-carboxylic acid. InChIKey: ZUWDKKMUSSQAPT-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-cyclopropyl-6,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | ZUWDKKMUSSQAPT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3CC3)C(=O)O)C |
Computed by PubChem (NCBI)