Products 897648-59-8
CAS 897648-59-8 is the registry number for 1,3-Bis(1,1-dimethylethyl) 2-(4-methyl-2-pyrimidinyl)imidodicarbonate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-methylpyrimidin-2-yl)carbamate (CAS 897648-59-8) is a chemical compound with the molecular formula C15H23N3O4 and a molecular weight of 309.36 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-methylpyrimidin-2-yl)carbamate. InChIKey: ZRCCYTRFKAJAPL-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O4 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-methylpyrimidin-2-yl)carbamate |
| InChIKey | ZRCCYTRFKAJAPL-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC=C1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)