Products 89781-43-1
CAS 89781-43-1 is the registry number for (E)-Ethyl 4-(3,4-dimethoxyphenyl)-4-oxo-2-butenoate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Ethyl (E)-4-(3,4-dimethoxyphenyl)-4-oxobut-2-enoate (CAS 89781-43-1) is a chemical compound with the molecular formula C14H16O5 and a molecular weight of 264.27 g/mol. IUPAC name: ethyl (E)-4-(3,4-dimethoxyphenyl)-4-oxobut-2-enoate. InChIKey: WXFQMQWBEXMWOA-SOFGYWHQSA-N.
| Molecular formula | C14H16O5 |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | ethyl (E)-4-(3,4-dimethoxyphenyl)-4-oxobut-2-enoate |
| InChIKey | WXFQMQWBEXMWOA-SOFGYWHQSA-N |
| SMILES | CCOC(=O)/C=C/C(=O)C1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)