Products 89798-27-6
CAS 89798-27-6 is the registry number for D-Glucose-d12-1, 99.4%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 5 mg, 25 mg, 10 mg, 100 mg.
(2R,3S,4R,5R)-1,2,3,4,5,6,6-heptadeuterio-2,3,4,5,6-pentadeuteriooxyhexan-1-one (CAS 89798-27-6) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 192.23 g/mol. IUPAC name: (2R,3S,4R,5R)-1,2,3,4,5,6,6-heptadeuterio-2,3,4,5,6-pentadeuteriooxyhexan-1-one. InChIKey: GZCGUPFRVQAUEE-OUCVIOSLSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | (2R,3S,4R,5R)-1,2,3,4,5,6,6-heptadeuterio-2,3,4,5,6-pentadeuteriooxyhexan-1-one |
| InChIKey | GZCGUPFRVQAUEE-OUCVIOSLSA-N |
| SMILES | [2H]C(=O)[C@@]([2H])([C@]([2H])([C@@]([2H])([C@@]([2H])(C([2H])([2H])O[2H])O[2H])O[2H])O[2H])O[2H] |
Computed by PubChem (NCBI)