CAS 898265-48-0 is the registry number for Trans-methyl 4-aminoadamantane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-aminoadamantane-1-carboxylate (CAS 898265-48-0) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: methyl 4-aminoadamantane-1-carboxylate. InChIKey: IXBLQWDWMIYKKE-UHFFFAOYSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | methyl 4-aminoadamantane-1-carboxylate |
| InChIKey | IXBLQWDWMIYKKE-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC3CC(C1)C(C(C3)C2)N |
Computed by PubChem (NCBI)