Products 898379-93-6
CAS 898379-93-6 is the registry number for 2-(Propan-2-yl)imidazo(1,2-a)pyridine-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-propan-2-ylimidazo[1,2-a]pyridine-3-carbaldehyde (CAS 898379-93-6) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 2-propan-2-ylimidazo[1,2-a]pyridine-3-carbaldehyde. InChIKey: RJPCDSYQWGWCQN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 2-propan-2-ylimidazo[1,2-a]pyridine-3-carbaldehyde |
| InChIKey | RJPCDSYQWGWCQN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N2C=CC=CC2=N1)C=O |
Computed by PubChem (NCBI)