Products 898640-71-6
CAS 898640-71-6 is the registry number for 2-methyl-2-(4-nitrophenyl)-1-(4-phenylpiperazin-1-yl)propan-1-one. Offered by: Chemat. Available pack sizes: 1g.
2-methyl-2-(4-nitrophenyl)-1-(4-phenylpiperazin-1-yl)propan-1-one (CAS 898640-71-6) is a chemical compound with the molecular formula C20H23N3O3 and a molecular weight of 353.4 g/mol. IUPAC name: 2-methyl-2-(4-nitrophenyl)-1-(4-phenylpiperazin-1-yl)propan-1-one. InChIKey: YLVZTFUNQVNXPV-UHFFFAOYSA-N.
| Molecular formula | C20H23N3O3 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 2-methyl-2-(4-nitrophenyl)-1-(4-phenylpiperazin-1-yl)propan-1-one |
| InChIKey | YLVZTFUNQVNXPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)N2CCN(CC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)