Products 898791-46-3
CAS 898791-46-3 appears in our catalog under these names: Cyclopentyl(3-fluorophenyl)methanone, 95%, 3-Fluorophenyl cyclopentyl ketone, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Cyclopentyl-(3-fluorophenyl)methanone (CAS 898791-46-3) is a chemical compound with the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. IUPAC name: cyclopentyl-(3-fluorophenyl)methanone. InChIKey: GMAKXEZRHKICMG-UHFFFAOYSA-N.
| Molecular formula | C12H13FO |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | cyclopentyl-(3-fluorophenyl)methanone |
| InChIKey | GMAKXEZRHKICMG-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)