CAS 89939-69-5 is the registry number for 2-Methyl-5,6-dinitrobenzimidazole. Offered by: TRC. Available pack sizes: 1g.
2-methyl-5,6-dinitro-1H-benzimidazole (CAS 89939-69-5) is a chemical compound with the molecular formula C8H6N4O4 and a molecular weight of 222.16 g/mol. IUPAC name: 2-methyl-5,6-dinitro-1H-benzimidazole. InChIKey: HQZNVJXYOZAFJI-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O4 |
|---|---|
| Molecular weight | 222.16 g/mol |
| IUPAC name | 2-methyl-5,6-dinitro-1H-benzimidazole |
| InChIKey | HQZNVJXYOZAFJI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2N1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)