CAS 916212-29-8 is the registry number for 5-(Methoxycarbonyl)-[1,2,4]triazolo[4,3-a]pyrimidine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methoxycarbonyl-[1,2,4]triazolo[4,3-a]pyrimidine-7-carboxylic acid (CAS 916212-29-8) is a chemical compound with the molecular formula C8H6N4O4 and a molecular weight of 222.16 g/mol. IUPAC name: 5-methoxycarbonyl-[1,2,4]triazolo[4,3-a]pyrimidine-7-carboxylic acid. InChIKey: YQMPLECUWVIMPK-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O4 |
|---|---|
| Molecular weight | 222.16 g/mol |
| IUPAC name | 5-methoxycarbonyl-[1,2,4]triazolo[4,3-a]pyrimidine-7-carboxylic acid |
| InChIKey | YQMPLECUWVIMPK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC2=NN=CN12)C(=O)O |
Computed by PubChem (NCBI)