CAS 928323-86-8 appears in our catalog under these names: 4-(3-Nitrophenyl)-1,2,4-triazolidine-3,5-dione, 95%, 4-(3-Nitrophenyl)-1,2,4-triazolidine-3,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(3-nitrophenyl)-1,2,4-triazolidine-3,5-dione (CAS 928323-86-8) is a chemical compound with the molecular formula C8H6N4O4 and a molecular weight of 222.16 g/mol. IUPAC name: 4-(3-nitrophenyl)-1,2,4-triazolidine-3,5-dione. InChIKey: IAWBFWGMAXQZGG-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O4 |
|---|---|
| Molecular weight | 222.16 g/mol |
| IUPAC name | 4-(3-nitrophenyl)-1,2,4-triazolidine-3,5-dione |
| InChIKey | IAWBFWGMAXQZGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])N2C(=O)NNC2=O |
Computed by PubChem (NCBI)