CAS 89978-51-8 is the registry number for 2-Bromo-4-ethyl-1-nitrobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4-ethyl-1-nitrobenzene (CAS 89978-51-8) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-bromo-4-ethyl-1-nitrobenzene. InChIKey: GBEISVDFNGVXBL-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-bromo-4-ethyl-1-nitrobenzene |
| InChIKey | GBEISVDFNGVXBL-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)