Products 899947-07-0
CAS 899947-07-0 appears in our catalog under these names: STING–IN–7, STING-IN-7, 98.75%, 1-(3-Chloro-4-methylphenyl)-3-(1H-indol-3-yl)urea, 99%. Offered by: GLPBio, MedChemExpress, BLDpharm, Chemat. Available pack sizes: 1mg, 5mg, 10 mg, 5 mg, 50 mg, 100 mg, 25 mg, 10mg.
1-(3-chloro-4-methylphenyl)-3-(1H-indol-3-yl)urea (CAS 899947-07-0) is a chemical compound with the molecular formula C16H14ClN3O and a molecular weight of 299.75 g/mol. IUPAC name: 1-(3-chloro-4-methylphenyl)-3-(1H-indol-3-yl)urea. InChIKey: FWAWUBPOSFYSMU-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3O |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 1-(3-chloro-4-methylphenyl)-3-(1H-indol-3-yl)urea |
| InChIKey | FWAWUBPOSFYSMU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)NC2=CNC3=CC=CC=C32)Cl |
Computed by PubChem (NCBI)