Products 90060-42-7
CAS 90060-42-7 is the registry number for Nolomirole. Offered by: MedChemExpress. Available pack sizes: Get quote.
[6-(methylamino)-1-(2-methylpropanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl] 2-methylpropanoate (CAS 90060-42-7) is a chemical compound with the molecular formula C19H27NO4 and a molecular weight of 333.4 g/mol. IUPAC name: [6-(methylamino)-1-(2-methylpropanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl] 2-methylpropanoate. InChIKey: OMMYLOLVPCCZQZ-UHFFFAOYSA-N.
| Molecular formula | C19H27NO4 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | [6-(methylamino)-1-(2-methylpropanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl] 2-methylpropanoate |
| InChIKey | OMMYLOLVPCCZQZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC1=C(C2=C(CC(CC2)NC)C=C1)OC(=O)C(C)C |
Computed by PubChem (NCBI)