Products 900710-59-0
CAS 900710-59-0 appears in our catalog under these names: N-(3-Cyanophenyl)-2-methylpropanamide, 95%, N-(3-Cyanophenyl)-2-methylpropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
N-(3-cyanophenyl)-2-methylpropanamide (CAS 900710-59-0) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: N-(3-cyanophenyl)-2-methylpropanamide. InChIKey: JWBISRKEEZGPFB-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | N-(3-cyanophenyl)-2-methylpropanamide |
| InChIKey | JWBISRKEEZGPFB-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CC=CC(=C1)C#N |
Computed by PubChem (NCBI)