Products 90090-38-3

CAS 90090-38-3 is the registry number for ethyl 4-aminobenzenesulfonate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-aminobenzenesulfonate (CAS 90090-38-3) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: ethyl 4-aminobenzenesulfonate. InChIKey: CIMOVGXLLJFXQW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11NO3S
Molecular weight201.25 g/mol
IUPAC nameethyl 4-aminobenzenesulfonate
InChIKeyCIMOVGXLLJFXQW-UHFFFAOYSA-N
SMILESCCOS(=O)(=O)C1=CC=C(C=C1)N

Computed by PubChem (NCBI)