CAS 90090-38-3 is the registry number for ethyl 4-aminobenzenesulfonate. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-aminobenzenesulfonate (CAS 90090-38-3) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: ethyl 4-aminobenzenesulfonate. InChIKey: CIMOVGXLLJFXQW-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | ethyl 4-aminobenzenesulfonate |
| InChIKey | CIMOVGXLLJFXQW-UHFFFAOYSA-N |
| SMILES | CCOS(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)