Products 90244-44-3

CAS 90244-44-3 is the registry number for Methyl 2,3,5-tri-O-acetyl-D-arabinofuranoside. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

(3,4-diacetyloxy-5-methoxyoxolan-2-yl)methyl acetate (CAS 90244-44-3) is a chemical compound with the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. IUPAC name: (3,4-diacetyloxy-5-methoxyoxolan-2-yl)methyl acetate. InChIKey: RUSRQHXGPHZZNI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18O8
Molecular weight290.27 g/mol
IUPAC name(3,4-diacetyloxy-5-methoxyoxolan-2-yl)methyl acetate
InChIKeyRUSRQHXGPHZZNI-UHFFFAOYSA-N
SMILESCC(=O)OCC1C(C(C(O1)OC)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)