CAS 90302-91-3 is the registry number for (S)–benzyl (1–((3–chloro–2–oxopropyl)amino)–1–oxopropan–2–yl)carbamate. Offered by: GLPBio. Available pack sizes: 200mg.
Benzyl N-[(2S)-1-[(3-chloro-2-oxopropyl)amino]-1-oxopropan-2-yl]carbamate (CAS 90302-91-3) is a chemical compound with the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. IUPAC name: benzyl N-[(2S)-1-[(3-chloro-2-oxopropyl)amino]-1-oxopropan-2-yl]carbamate. InChIKey: NOEXDCVLDWYOTB-JTQLQIEISA-N.
| Molecular formula | C14H17ClN2O4 |
|---|---|
| Molecular weight | 312.75 g/mol |
| IUPAC name | benzyl N-[(2S)-1-[(3-chloro-2-oxopropyl)amino]-1-oxopropan-2-yl]carbamate |
| InChIKey | NOEXDCVLDWYOTB-JTQLQIEISA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)CCl)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)