CAS 90349-18-1 is the registry number for 4-(Ethylamino)-3-nitrobenzonitrile, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
4-(ethylamino)-3-nitrobenzonitrile (CAS 90349-18-1) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 4-(ethylamino)-3-nitrobenzonitrile. InChIKey: QIOBDXXEMGRNQX-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 4-(ethylamino)-3-nitrobenzonitrile |
| InChIKey | QIOBDXXEMGRNQX-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=C(C=C1)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)