Products 903556-85-4
CAS 903556-85-4 is the registry number for 5-(Aminomethyl)benzo[d]oxazol-2(3H)-one hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-(aminomethyl)-3H-1,3-benzoxazol-2-one;hydrochloride (CAS 903556-85-4) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 5-(aminomethyl)-3H-1,3-benzoxazol-2-one;hydrochloride. InChIKey: ARINPZHIQKLUAU-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 5-(aminomethyl)-3H-1,3-benzoxazol-2-one;hydrochloride |
| InChIKey | ARINPZHIQKLUAU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CN)NC(=O)O2.Cl |
Computed by PubChem (NCBI)