Products 903558-70-3
CAS 903558-70-3 appears in our catalog under these names: 1-(3-(Aminomethyl)phenyl)-3,3-dimethylurea hydrochloride, 1-(3-(Aminomethyl)phenyl)-3,3-dimethylurea hydrochloride, 95%, 1-[3-(AMINOMETHYL)PHENYL]-3,3-DIMETHYLUREA HYDROCHLORIDE, 95%, 95%. Offered by: Biosynth, AmBeed, Chemat. Available pack sizes: 0,5g, 50mg, 5g, 1g, 100mg, 250mg.
3-[3-(aminomethyl)phenyl]-1,1-dimethylurea;hydrochloride (CAS 903558-70-3) is a chemical compound with the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. IUPAC name: 3-[3-(aminomethyl)phenyl]-1,1-dimethylurea;hydrochloride. InChIKey: BWQAUKMFXJMRLA-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3O |
|---|---|
| Molecular weight | 229.71 g/mol |
| IUPAC name | 3-[3-(aminomethyl)phenyl]-1,1-dimethylurea;hydrochloride |
| InChIKey | BWQAUKMFXJMRLA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC=CC(=C1)CN.Cl |
Computed by PubChem (NCBI)