Products 90366-30-6

CAS 90366-30-6 is the registry number for 3,4,5,6-Tetra-O-acetyl myo-Inositol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 2000mg.

Structural formula: {0} (CAS {1})

(2,3,4-triacetyloxy-5,6-dihydroxycyclohexyl) acetate (CAS 90366-30-6) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: (2,3,4-triacetyloxy-5,6-dihydroxycyclohexyl) acetate. InChIKey: ZQLBHQSQMQLFBM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20O10
Molecular weight348.30 g/mol
IUPAC name(2,3,4-triacetyloxy-5,6-dihydroxycyclohexyl) acetate
InChIKeyZQLBHQSQMQLFBM-UHFFFAOYSA-N
SMILESCC(=O)OC1C(C(C(C(C1OC(=O)C)OC(=O)C)OC(=O)C)O)O

Computed by PubChem (NCBI)