CAS 90418-57-8 appears in our catalog under these names: Cinnoline-4-carbaldehyde, 98+%, 4-Cinnolinecarboxaldehyde. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1000mg, 500mg.
Cinnoline-4-carbaldehyde (CAS 90418-57-8) is a chemical compound with the molecular formula C9H6N2O and a molecular weight of 158.16 g/mol. IUPAC name: cinnoline-4-carbaldehyde. InChIKey: CORTZCFBTFGJGU-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | cinnoline-4-carbaldehyde |
| InChIKey | CORTZCFBTFGJGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=N2)C=O |
Computed by PubChem (NCBI)