Products 904236-46-0

CAS 904236-46-0 is the registry number for 2-(1-(2-Naphthyl)ethyl)benzoic Acid. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.

Structural formula: {0} (CAS {1})

2-(1-naphthalen-2-ylethyl)benzoic acid (CAS 904236-46-0) is a chemical compound with the molecular formula C19H16O2 and a molecular weight of 276.3 g/mol. IUPAC name: 2-(1-naphthalen-2-ylethyl)benzoic acid. InChIKey: VGPUVBCHZSXLPG-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16O2
Molecular weight276.3 g/mol
IUPAC name2-(1-naphthalen-2-ylethyl)benzoic acid
InChIKeyVGPUVBCHZSXLPG-UHFFFAOYSA-N
SMILESCC(C1=CC2=CC=CC=C2C=C1)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)