CAS 904328-95-6 appears in our catalog under these names: Flutamide Impurity 13, N-Hydroxy-4-nitro-3-(trifluoromethyl)aniline (FLU-1-N-OH). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
N-[4-nitro-3-(trifluoromethyl)phenyl]hydroxylamine (CAS 904328-95-6) is a chemical compound with the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. IUPAC name: N-[4-nitro-3-(trifluoromethyl)phenyl]hydroxylamine. InChIKey: FEPOPFNZFBGHBA-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O3 |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | N-[4-nitro-3-(trifluoromethyl)phenyl]hydroxylamine |
| InChIKey | FEPOPFNZFBGHBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NO)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)