CAS 904627-63-0 appears in our catalog under these names: 2-(3,4-Dimethylphenoxy)propanamide, 95%, 2-(3,4-Dimethylphenoxy)propanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(3,4-dimethylphenoxy)propanamide (CAS 904627-63-0) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-(3,4-dimethylphenoxy)propanamide. InChIKey: VSLXOVLUFAEKNH-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-(3,4-dimethylphenoxy)propanamide |
| InChIKey | VSLXOVLUFAEKNH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC(C)C(=O)N)C |
Computed by PubChem (NCBI)