CAS 90485-25-9 appears in our catalog under these names: Sotalol Impurity 5, N-(4-(2-Bromoethyl)phenyl)methanesulfonamide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-[4-(2-bromoethyl)phenyl]methanesulfonamide (CAS 90485-25-9) is a chemical compound with the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. IUPAC name: N-[4-(2-bromoethyl)phenyl]methanesulfonamide. InChIKey: PTEMXZYFVMYQKW-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S |
|---|---|
| Molecular weight | 278.17 g/mol |
| IUPAC name | N-[4-(2-bromoethyl)phenyl]methanesulfonamide |
| InChIKey | PTEMXZYFVMYQKW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)CCBr |
Computed by PubChem (NCBI)